On Target PR_HIV1 0.17525773/CHEMBL467420
For the given ligand DB09403, we have found in our database that, being scored 0.17525773, the most similar ligand is CHEMBL467420. Check out the elaboration below.
| DB09403 (Given Ligand) | CHEMBL467420 (Similar Ligand) |
|---|---|
| CC(=O)N(C[C@H](C)C(=O)O)c1c(I)cc(I)c(N)c1I | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCCOCOC2)cc1 |
|
|
|
|
|
|
| 00005002 00001000 00100000 00000600 28000000 00000000 00000000 00000000 00000001 00000840 00280004 50019000 08008042 02100000 000a0040 00080008 00040000 00000001 08800110 00000204 40110040 18100e00 21002080 00100018 00081001 00100000 00800420 10000080 00808000 00060001 00200000 00000200 | 00000010 01c05409 2110050a 01b10700 00281080 00028000 02002800 a8000004 00742a00 004809e0 08302000 60018010 00008002 02200101 81e80001 003a0008 10822000 02080000 10408800 01027603 80100100 18280c90 07100040 d9500058 02000000 8000100e 00800000 342000cc 04000600 20060013 80200000 00012670 |