On Target NS3_HCV1A 0.24761905/CHEMBL3891173
For the given ligand DB09403, we have found in our database that, being scored 0.24761905, the most similar ligand is CHEMBL3891173. Check out the elaboration below.
| DB09403 (Given Ligand) | CHEMBL3891173 (Similar Ligand) |
|---|---|
| CC(=O)N(C[C@H](C)C(=O)O)c1c(I)cc(I)c(N)c1I | CC(C)c1ccc2c(Nc3cc(NC(=O)[C@@H]4CCCN4C(=O)OCc4ccccc4)ccc3Sc3ccc(N)cc3)ncnc2n1 |
|
|
|
|
|
|
| 00005002 00001000 00100000 00000600 28000000 00000000 00000000 00000000 00000001 00000840 00280004 50019000 08008042 02100000 000a0040 00080008 00040000 00000001 08800110 00000204 40110040 18100e00 21002080 00100018 00081001 00100000 00800420 10000080 00808000 00060001 00200000 00000200 | 0101400a 01c03a00 001a4120 1c190600 2c040020 0001e010 00009810 00000808 10802300 00080ac0 08389004 6081b810 0e008812 00912000 80020040 1a1e000e 04061000 72084400 0860089a 12200201 c0100000 38048e70 20806041 8258001f 00084000 80102202 022084d0 10a000a0 08c0820c 01460003 e000c000 200106e0 |