On Target NS5B_HCV1B 0.30819672/CHEMBL3970609
For the given ligand DB00997, we have found in our database that, being scored 0.30819672, the most similar ligand is CHEMBL3970609. Check out the elaboration below.
| DB00997 (Given Ligand) | CHEMBL3970609 (Similar Ligand) |
|---|---|
| COc4cccc5c(=O)c3c(O)c2C[C@](O)(C(=O)CO)C[C@H](O[C@H]1C[C@@H](N)[C@@H](O)[C@H](C)O1)c2c(O)c3c(=O)c45 | CO[C@]1(c2ccc3c(N)ncnn23)O[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H](O)[C@]1(C)C#N |
|
|
|
|
|
|
| 00050040 4b000808 2000050a 40050700 88281051 4002c402 17103c40 09000a01 00200900 01080ae8 2c100000 4000db40 04008002 22a90000 01044021 2a28b008 08a00a00 02000100 11d8a008 40020201 00101520 b8020260 07004068 0a420414 00000c00 e0002201 00080800 64800024 02000383 00074802 c2e00004 02400400 | 0000080a 81004009 e2401512 19010f20 052c8074 0012c024 0381e800 00200a80 1060cb00 010c0060 08108004 4a839040 00000802 02b30020 000e0040 022cba0c 09cb8820 0680000e 1160a008 00665203 40100121 2c008860 a5801cc6 08600110 40000400 80002102 160880c0 a40508a0 0040020e 00c6cc16 41600280 6220ac82 |