On Target RT_HIV1 0.25776398/CHEMBL4108147
For the given ligand DB00997, we have found in our database that, being scored 0.25776398, the most similar ligand is CHEMBL4108147. Check out the elaboration below.
| DB00997 (Given Ligand) | CHEMBL4108147 (Similar Ligand) |
|---|---|
| COc4cccc5c(=O)c3c(O)c2C[C@](O)(C(=O)CO)C[C@H](O[C@H]1C[C@@H](N)[C@@H](O)[C@H](C)O1)c2c(O)c3c(=O)c45 | COC(=O)N[C@H](C(=O)NCc1ccc([C@@H](CO)N(CC2CC(F)(F)C2)S(=O)(=O)c2ccc3c(c2)COCC3)s1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 00050040 4b000808 2000050a 40050700 88281051 4002c402 17103c40 09000a01 00200900 01080ae8 2c100000 4000db40 04008002 22a90000 01044021 2a28b008 08a00a00 02000100 11d8a008 40020201 00101520 b8020260 07004068 0a420414 00000c00 e0002201 00080800 64800024 02000383 00074802 c2e00004 02400400 | 00010010 09803200 03188100 05b10601 100801da 0003c000 04000081 2300504e 02c60b00 004918c0 09302200 e001b880 8c008812 00212031 806c2480 021e030c 18423000 0219000c 0470001a 0000660d 80011920 782c8eb0 03104000 db500058 42000c00 e4012206 40080820 d000302c 0c200781 2406080f e0004000 02c107f0 |