On Target NS3_HCV1A 0.28163266/CHEMBL3905267
For the given ligand DB00254, we have found in our database that, being scored 0.28163266, the most similar ligand is CHEMBL3905267. Check out the elaboration below.
| DB00254 (Given Ligand) | CHEMBL3905267 (Similar Ligand) |
|---|---|
| C[C@@H]4c1cccc(O)c1C(=O)/C3=C(O)/[C@@]2(O)C(=O)/C(C(N)=O)=C(O)\[C@H](N(C)C)[C@H]2[C@@H](O)[C@H]34 | COc1cc(C(=O)c2c(Cl)ccc([C@H](N[C@@H](C)CC(N)=O)C3CC3)c2F)ccc1C#N |
|
|
|
|
|
|
| 00070030 c3008808 22901b02 0031060a 00390080 40828003 020010c1 28000e03 91040940 00d888ca 08300200 4041d040 9c02812a 03a10000 00000424 00082108 20004600 02100120 01e52010 00032a01 00400100 180207d0 0700c0c0 00540014 00201000 88004401 00404200 90000080 04004002 00064002 b4020000 00c10e00 | 000080c4 43000c08 2010010a 42010600 00001221 00000010 32000000 23001000 00000900 00880fc0 08300000 40809a00 0e008866 21201004 01004401 28082008 03400200 03000000 00880410 00020201 00000502 18028700 01000400 30420014 00003000 e0000200 08040000 d0800081 00000380 00068432 a4040000 00022600 |