On Target NSP1_SARS 0.3125/CHEMBL2441741
For the given ligand DB12839, we have found in our database that, being scored 0.3125, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| DB12839 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| COCCOCCCCCC(=O)NCCCC[C@H](N)C(=O)O | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00010000 01001000 00100000 00010500 00080000 00000000 00000000 20000040 00002000 00000080 00200000 4001b000 0400800a 00800000 00000000 00089008 00800000 00000000 00402000 00000201 00000020 10040e30 07000000 08100018 00000400 00000000 00000000 10000020 00000200 00040001 00000000 00002200 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |