On Target NP_HCoV-OC43 0.13541667/CHEMBL3233481
For the given ligand DB04825, we have found in our database that, being scored 0.13541667, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| DB04825 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| C[C@@H](Cc1ccccc1)NCCC(c2ccccc2)c3ccccc3 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000000 00000200 00100100 00010600 00000000 00000000 00000000 21000000 00000880 000808c0 08300000 40008000 00000002 00000000 00000000 00040000 00000000 02000000 00000000 00000201 00000100 18200000 00000000 81400010 00000000 a0000000 00000000 50000000 04000080 0006000a 00000000 00002600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |