On Target NS5B_HCV1B 0.34201956/CHEMBL3645182
For the given ligand DB15305, we have found in our database that, being scored 0.34201956, the most similar ligand is CHEMBL3645182. Check out the elaboration below.
| DB15305 (Given Ligand) | CHEMBL3645182 (Similar Ligand) |
|---|---|
| Cc6cn5nc(c4cc(=O)n3cc(N2CCNC1(CC1)C2)ccc3n4)cc(C)c5n6 | CNC(=O)c1c2cc(C3CC3)c(N(CCN3CCOCC3)S(C)(=O)=O)cc2nn1-c1ccc(Oc2ccc(F)cc2)cc1 |
|
|
|
|
|
|
| 0000e002 40800808 e01851b0 1c040630 210c1064 08006036 14c00000 20080d00 06000100 110002f0 85218004 60000800 86008802 09d02000 00160841 020c260c 08268800 0280f00c 0c600000 c0660207 40180009 3c028020 31802863 8270491a 00140402 c0100000 38020420 100408e5 0842400c 00463400 40040c80 002046a0 | 00004086 00805e08 2018092a c7310e00 010c1080 00004052 02060000 02001408 00100900 00090ac0 09312024 40118800 80008c23 01403201 811a1049 000ea10c 14268000 02000004 08602008 00624201 c0500101 3c838e38 32801800 a360003e 02104480 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |