On Target NS3_HCV1B 0.29438204/CHEMBL297884
For the given ligand DB09050, we have found in our database that, being scored 0.29438204, the most similar ligand is CHEMBL297884. Check out the elaboration below.
| DB09050 (Given Ligand) | CHEMBL297884 (Similar Ligand) |
|---|---|
| Cn1c(N)c(NC(=O)NCCN)c[n+]1C/C4=C(C(=O)[O-])/N3C(=O)[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c2nsc(N)n2)[C@H]3SC4 | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@H]5/C=C\CCCCC[C@H](NC(=O)OC5CCCC5)C(=O)N4C3)cc(-c3csc(NC(C)C)n3)nc2c1 |
|
|
|
|
|
|
| 04400087 c2806858 a0534200 0c310f60 01090088 98002000 c22c032c 9022a50d 1338a581 9a07c2c1 012b968d 600df941 8e01f886 00ac2105 851f0087 004c405c 74e00d01 08c443c0 21c10018 0372272c c0008580 b9018f92 af9a7b01 16400018 45001202 2c400f24 40c54020 c40605d8 0c00100c e0463123 24087091 a3b383e8 | 04072002 c9427008 a0104908 14810702 211c10a0 02118050 c6080100 b00a848a 10800300 2010c8ca 00202a04 5101b420 0e82881a 01502183 911a3441 021e200c 10a24000 120861c4 44e82818 12e63a01 40080000 3914aef8 f390c883 82510018 00a01081 8c101002 00e04240 90200465 0c00420c 850e2403 e4065800 04252a42 |