On Target NS3_HCV1B 0.34513274/CHEMBL3927196
For the given ligand DB12839, we have found in our database that, being scored 0.34513274, the most similar ligand is CHEMBL3927196. Check out the elaboration below.
| DB12839 (Given Ligand) | CHEMBL3927196 (Similar Ligand) |
|---|---|
| COCCOCCCCCC(=O)NCCCC[C@H](N)C(=O)O | CC(C)=CC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC2[C@@H]([C@H]1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C2(C)C |
|
|
|
|
|
|
| 00010000 01001000 00100000 00010500 00080000 00000000 00000000 20000040 00002000 00000080 00200000 4001b000 0400800a 00800000 00000000 00089008 00800000 00000000 00402000 00000201 00000020 10040e30 07000000 08100018 00000400 00000000 00000000 10000020 00000200 00040001 00000000 00002200 | 00030000 01403400 00100000 04000600 00000000 00018010 00000000 20000408 05800200 00120180 00200000 5001b000 0e02801a 01002011 80000400 001a0008 00020000 00080001 00012810 00000201 00000000 300c0e70 00008003 02100018 00001000 00000002 00404000 90200020 08000200 00040011 a4024000 00802200 |