On Target PR_SARS 0.31034482/CHEMBL2441741
For the given ligand DB01061, we have found in our database that, being scored 0.31034482, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| DB01061 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| CC4(C)S[C@@H]3[C@@H](NC(=O)[C@H](NC(=O)N1CCNC1=O)c2ccccc2)C(=O)N3[C@@H]4C(=O)O | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00010000 47807000 20164360 0c310e40 00000080 00000000 00201204 02003008 00000080 0a0e4840 0b200003 4004b000 0f01e806 000c2101 c0180001 00480008 14004410 02002200 00400050 00400309 c0020100 38238e00 03000703 87400018 00001200 80000020 00004000 80000000 0c001100 00060023 20046011 83012680 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |