On Target NS5B_HCV1A 0.2636816/CHEMBL163917
For the given ligand DB00558, we have found in our database that, being scored 0.2636816, the most similar ligand is CHEMBL163917. Check out the elaboration below.
| DB00558 (Given Ligand) | CHEMBL163917 (Similar Ligand) |
|---|---|
| CC(=O)N[C@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@@H]1[C@H](O)[C@@H](O)CO | CC(C)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)OC(C)(C)C)C(=O)N[C@@H](CC(F)F)C(=O)C(=O)O |
|
|
|
|
|
|
| 00000008 89047200 00100041 90010d01 003880c1 00000200 000b0180 38800c00 01000000 011004ca 80200010 4001c000 80028002 01880008 02001408 390b9008 30200804 82000140 51c16010 00082201 00000020 30140fb0 1f008081 0a10001c 00021481 80000c00 40c14000 90100121 08804240 00048401 2c060000 00804a00 | 00030000 01403000 00100000 04000600 00181000 00018000 00000000 20000008 04800200 00020080 00200000 4001f000 0e008032 01002001 80000000 001a0408 000a0000 00080001 00c00810 00000201 00000000 30140e50 01000083 02100018 00001001 00000082 00000060 90200020 08000200 02040001 a0004000 00802a00 |