On Target PR_HIV1 0.28323698/CHEMBL492666
For the given ligand DB00279, we have found in our database that, being scored 0.28323698, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| DB00279 (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| N[C@H](Cc2cc(I)c(Oc1ccc(O)c(I)c1)c(I)c2)C(=O)O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00001000 46000008 a0300108 00010600 00001000 00000008 02040000 00000040 00000800 00080840 08100000 4800b000 04008042 02002000 01080001 00080058 00000000 02000000 00402108 00020001 00410140 18002a00 03000040 81400010 00000800 80000000 001a0000 00200000 04000200 00060002 00200400 02000400 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |