On Target PR_HIV1 0.20652173/CHEMBL510485
For the given ligand DB00800, we have found in our database that, being scored 0.20652173, the most similar ligand is CHEMBL510485. Check out the elaboration below.
| DB00800 (Given Ligand) | CHEMBL510485 (Similar Ligand) |
|---|---|
| Oc3ccc([C@H]2CNCCc1c(Cl)c(O)c(O)cc12)cc3 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCCOCCOC2)cc1 |
|
|
|
|
|
|
| 00008000 46000008 20110100 00010600 00000020 80000000 16000400 01000001 00000080 00080844 08200000 40808900 02000006 00200002 80000000 00008008 00000200 02100000 00100000 00020200 00000400 18200100 00004000 814a0010 00002000 a0000a00 00120000 40000000 06000080 00060002 00000000 00022600 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e80001 001a8008 10022000 02080000 01400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000000e 00800000 102000ec 04000600 20060013 80000000 00012670 |