On Target PA_INFA 0.2820513/CHEMBL3600947
For the given ligand DB00800, we have found in our database that, being scored 0.2820513, the most similar ligand is CHEMBL3600947. Check out the elaboration below.
| DB00800 (Given Ligand) | CHEMBL3600947 (Similar Ligand) |
|---|---|
| Oc3ccc([C@H]2CNCCc1c(Cl)c(O)c(O)cc12)cc3 | O=C(COc1ccc(F)cc1)c1ccc(O)c(O)c1O |
|
|
|
|
|
|
| 00008000 46000008 20110100 00010600 00000020 80000000 16000400 01000001 00000080 00080844 08200000 40808900 02000006 00200002 80000000 00008008 00000200 02100000 00100000 00020200 00000400 18200100 00004000 814a0010 00002000 a0000a00 00120000 40000000 06000080 00060002 00000000 00022600 | 04001001 42000808 20110109 02010200 00001041 02020010 02000000 00000240 00000000 00080840 08040000 4000c100 00808002 00001000 01040001 2008a008 08000000 82000000 04000000 00420a00 00000000 08020200 01001000 00400014 00000000 80000000 00120008 00000001 00000200 00028002 80000000 00000600 |