On Target NS3_HCV1A 0.3548387/CHEMBL4107993
For the given ligand DB00279, we have found in our database that, being scored 0.3548387, the most similar ligand is CHEMBL4107993. Check out the elaboration below.
| DB00279 (Given Ligand) | CHEMBL4107993 (Similar Ligand) |
|---|---|
| N[C@H](Cc2cc(I)c(Oc1ccc(O)c(I)c1)c(I)c2)C(=O)O | CC[C@@H](N)c1ccc(OC)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 00001000 46000008 a0300108 00010600 00001000 00000008 02040000 00000040 00000800 00080840 08100000 4800b000 04008042 02002000 01080001 00080058 00000000 02000000 00402108 00020001 00410140 18002a00 03000040 81400010 00000800 80000000 001a0000 00200000 04000200 00060002 00200400 02000400 | 00000040 00000808 20100108 02010600 00001201 00020010 02040000 01001200 00000800 00088e40 08100000 40008200 00008842 00001000 01000001 08082008 03000200 02000000 00000400 00020001 00000100 18028200 01000000 12400014 00000000 e0000000 08320800 40800001 00000380 00068002 82040010 00000600 |