On Target NP_HCoV-OC43 0.08139535/CHEMBL3233481
For the given ligand DB06145, we have found in our database that, being scored 0.08139535, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| DB06145 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CO[C@H]2[C@H](O)CC(=O)O[C@H](C)C/C=C\C=C/[C@H](O[C@@H]1CC[C@@H](N(C)C)[C@@H](C)O1)[C@H](C)C[C@H](CC=O)[C@H]2O[C@@H]4O[C@H](C)[C@H](O[C@H]3C[C@@](C)(O)[C@@H](O)[C@@H](C)O3)[C@H](N(C)C)[C@@H]4O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00050040 01040000 00100100 80810700 c03801c0 00800001 02003800 08000440 00202000 011000a0 40200200 40009000 14028028 028a0000 0000140c 002a900c 00a20040 00000100 31c0a090 00008001 00100020 10001a00 1740a080 08000012 10001400 00000000 00406200 b4000020 00000242 00040000 24e20000 04000a10 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |