On Target PR_HIV1 0.2290749/CHEMBL3645125
For the given ligand DB06145, we have found in our database that, being scored 0.2290749, the most similar ligand is CHEMBL3645125. Check out the elaboration below.
| DB06145 (Given Ligand) | CHEMBL3645125 (Similar Ligand) |
|---|---|
| CO[C@H]2[C@H](O)CC(=O)O[C@H](C)C/C=C\C=C/[C@H](O[C@@H]1CC[C@@H](N(C)C)[C@@H](C)O1)[C@H](C)C[C@H](CC=O)[C@H]2O[C@@H]4O[C@H](C)[C@H](O[C@H]3C[C@@](C)(O)[C@@H](O)[C@@H](C)O3)[C@H](N(C)C)[C@@H]4O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CC3OCOCO[C@@H]3C2)cc1 |
|
|
|
|
|
|
| 00050040 01040000 00100100 80810700 c03801c0 00800001 02003800 08000440 00202000 011000a0 40200200 40009000 14028028 028a0000 0000140c 002a900c 00a20040 00000100 31c0a090 00008001 00100020 10001a00 1740a080 08000012 10001400 00000000 00406200 b4000020 00000242 00040000 24e20000 04000a10 | 00000010 01c05408 2110010a 01b10700 00281080 00028000 02002800 a0000004 00742a00 014809e0 08302000 60018000 00008002 02200101 81e80001 003a0008 10822000 02080000 11408800 81027603 80100100 18280c90 07100040 d9500058 02000000 8000100e 00800000 3420008c 04000600 2106001b 80a00000 00012670 |