On Target PA_INFA 0.22807017/CHEMBL2040554
For the given ligand DB06145, we have found in our database that, being scored 0.22807017, the most similar ligand is CHEMBL2040554. Check out the elaboration below.
| DB06145 (Given Ligand) | CHEMBL2040554 (Similar Ligand) |
|---|---|
| CO[C@H]2[C@H](O)CC(=O)O[C@H](C)C/C=C\C=C/[C@H](O[C@@H]1CC[C@@H](N(C)C)[C@@H](C)O1)[C@H](C)C[C@H](CC=O)[C@H]2O[C@@H]4O[C@H](C)[C@H](O[C@H]3C[C@@](C)(O)[C@@H](O)[C@@H](C)O3)[C@H](N(C)C)[C@@H]4O | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(CC2CCCCC2)CC1 |
|
|
|
|
|
|
| 00050040 01040000 00100100 80810700 c03801c0 00800001 02003800 08000440 00202000 011000a0 40200200 40009000 14028028 028a0000 0000140c 002a900c 00a20040 00000100 31c0a090 00008001 00100020 10001a00 1740a080 08000012 10001400 00000000 00406200 b4000020 00000242 00040000 24e20000 04000a10 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 28000400 01100800 001808c0 08300000 5001d800 86028026 00200000 00000400 00080008 00000000 02000000 02252018 00000201 00000100 18000b90 04008000 00500010 00003800 80002400 00444000 90000000 00004000 00060002 04020000 00822600 |