On Target ACE2_HUMAN 0.13375796/CHEMBL257026
For the given ligand DB01222, we have found in our database that, being scored 0.13375796, the most similar ligand is CHEMBL257026. Check out the elaboration below.
| DB01222 (Given Ligand) | CHEMBL257026 (Similar Ligand) |
|---|---|
| CCC[C@H]5O[C@H]4C[C@H]3[C@@H]2CC/C1=C/C(=O)/C=C\[C@]1(C)[C@H]2[C@H](O)C[C@]3(C)[C@]4(C(=O)CO)O5 | O=C(O)[C@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)[C@@H](S)C1CCCCC1 |
|
|
|
|
|
|
| 00010042 81000000 00000000 00090100 003c0040 00200004 00000880 0a000402 01200000 01100020 00000000 4000d000 14028028 02800000 00000400 08289008 00800000 80000000 1341a000 00022001 00000021 00000280 05008000 08000814 00200400 00000000 00404000 a4000020 00000200 01000000 24a20000 00000000 | 00012000 01005000 00100100 00110600 00000080 00000000 80000000 20000004 00200980 020a08c0 08300000 4003b800 0600800a 00040000 80080000 00080008 10020000 02000000 06402008 10000201 00000100 18200e10 13000140 85500018 00000800 80000000 00000000 10000040 04004000 00060003 20024000 03012600 |