On Target NP_HCoV-OC43 0.07746479/CHEMBL3233481
For the given ligand Naringenin, we have found in our database that, being scored 0.07746479, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Naringenin (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| O=C2CC(c1ccc(O)cc1)Oc3cc(O)cc(O)c23 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 04000001 01000818 2000010b 00010300 00001000 82224000 42000000 00000200 00000900 00080840 08100000 40009060 14808002 00210000 11000001 020a2008 00000000 02008000 00400008 00020801 00000100 08020220 01000060 00c01014 00004800 c0002000 00520800 00000000 00010300 00034002 c0000000 00000400 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |