On Target NP_HCoV-OC43 0.09389672/CHEMBL3233481
For the given ligand Virus T, we have found in our database that, being scored 0.09389672, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Virus T (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(SSCc1nncc2c1OCC3CCCOC23)C4CC4 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 04004040 43000018 6010218a 40910710 81080154 6a00830a 40002001 00800a00 10800900 01080808 00100040 6804a040 0a001046 0ba50000 11000800 020c301c 80a40911 22008304 01602000 402e0201 80030064 3c000000 01800940 02400418 00102401 c0000000 111a0200 10100000 04018306 00064182 c0004004 0b410020 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |