On Target NA_INFB 0.2189781/CHEMBL79499
For the given ligand 2, we have found in our database that, being scored 0.2189781, the most similar ligand is CHEMBL79499. Check out the elaboration below.
| 2 (Given Ligand) | CHEMBL79499 (Similar Ligand) |
|---|---|
| c1cc2CCCCC3CCCc(c1)c23 | CC[C@H](CCc1ccccc1)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000002 00000000 00000001 00000800 00080840 08100000 40008000 00000000 00200000 00000020 00080008 01000200 02000000 00002000 00000001 00000100 08000000 01004000 00400010 00000000 80000001 00000000 00800000 00000002 00020002 00020000 00000400 | 00070040 09007008 00100102 80010700 00180080 00000800 02080180 38000402 11000800 001808c8 48300000 41019001 0402801a 01a80000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000120 38040e80 13008040 02500018 10001400 80001400 00c04000 90000001 0c000202 00060403 04020000 00000610 |