On Target NS5B_HCV1A 0.30851063/CHEMBL367415
For the given ligand 2, we have found in our database that, being scored 0.30851063, the most similar ligand is CHEMBL367415. Check out the elaboration below.
| 2 (Given Ligand) | CHEMBL367415 (Similar Ligand) |
|---|---|
| c1cc2CCCCC3CCCc(c1)c23 | N#Cc1c(Cl)cccc1-c1cccc(C(=O)CC(=O)C(=O)O)c1 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000002 00000000 00000001 00000800 00080840 08100000 40008000 00000000 00200000 00000020 00080008 01000200 02000000 00002000 00000001 00000100 08000000 01004000 00400010 00000000 80000001 00000000 00800000 00000002 00020002 00020000 00000400 | 0005a000 01000801 00000102 00810200 00080021 00000000 04000000 00000000 04100900 00880840 08100000 4001d800 06008004 00200008 a0000000 08082008 00420000 02001000 04c00008 00002001 00000100 08020b00 11000480 00400014 00002800 80000280 00000000 00000041 10004002 00020402 80000000 00420400 |