On Target NA_A-H3N8 0.2748815/CHEMBL4292761
For the given ligand Narlaprevir, we have found in our database that, being scored 0.2748815, the most similar ligand is CHEMBL4292761. Check out the elaboration below.
| Narlaprevir (Given Ligand) | CHEMBL4292761 (Similar Ligand) |
|---|---|
| CCCCC(NC(=O)C1[C@@H]3[C@H](CN1C(=O)C(NC(=O)NC2(CS(=O)(=O)C(C)(C)C)CCCCC2)C(C)(C)C)C3(C)C)C(=O)C(=O)NC4CC4 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(SC3CCCCC3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00010000 45003400 20100000 04100c00 00000000 00000090 00000004 20002008 04220000 020241a0 00202000 50033000 0e01b01e 01042101 c0000000 00000000 04000010 00020001 02002050 00000301 40000100 300d0631 00000303 0a3c0018 00011000 00000000 00004000 10000020 08000000 00040031 200a4000 03012220 | 00070040 09807200 00120100 84110700 00180080 00000800 02080180 3a00140a 15200000 001148c8 40600000 61039001 0403881a 018d2000 02001408 00081008 14a04000 02000060 62c16010 00000201 80000020 380c8e80 13808180 02700019 10003401 c0001400 00c04000 90000001 0c000300 00060401 34060000 01810a30 |