On Target NS5B_HCV2A 0.2977528/CHEMBL3127326
For the given ligand Narlaprevir, we have found in our database that, being scored 0.2977528, the most similar ligand is CHEMBL3127326. Check out the elaboration below.
| Narlaprevir (Given Ligand) | CHEMBL3127326 (Similar Ligand) |
|---|---|
| CCCCC(NC(=O)C1[C@@H]3[C@H](CN1C(=O)C(NC(=O)NC2(CS(=O)(=O)C(C)(C)C)CCCCC2)C(C)(C)C)C3(C)C)C(=O)C(=O)NC4CC4 | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N2c2ccc(C(C)(C)C)cc2)cc1)C(C)C |
|
|
|
|
|
|
| 00010000 45003400 20100000 04100c00 00000000 00000090 00000004 20002008 04220000 020241a0 00202000 50033000 0e01b01e 01042101 c0000000 00000000 04000010 00020001 02002050 00000301 40000100 300d0631 00000303 0a3c0018 00011000 00000000 00004000 10000020 08000000 00040031 200a4000 03012220 | 00014002 01003800 00100122 c4010600 20000000 0001a010 00000000 22001008 00900a00 00080ac0 08380004 4001f000 0e008812 0030a001 80020440 00120008 00062000 02080000 08002010 00000201 40100100 38048e30 20012003 0250001a 00000000 c0000002 00000000 900000a0 08008302 00060003 a0044000 00002600 |