On Target NA_A-H3N8 0.21621622/CHEMBL4278505
For the given ligand C1, we have found in our database that, being scored 0.21621622, the most similar ligand is CHEMBL4278505. Check out the elaboration below.
| C1 (Given Ligand) | CHEMBL4278505 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc3ccc2c(=O)c1ccccc1[oH+]c2c3O | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(Cc3ccccc3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00000000 42000c08 20000108 40018202 00001000 00820000 02000001 01000600 00040104 00980840 08000000 40008800 0000c002 20000000 01000001 2000a008 00000000 02100000 00082000 00020a00 00400000 08020300 00008000 06420014 00000000 e8000000 00400800 40200000 00000380 00020002 87020400 00000400 | 00070040 09007000 00100100 84010700 00180080 00000800 02080180 3b00140a 11000100 001908c8 48200000 41019801 8402881a 01882000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000020 38048e80 13008080 02500018 10001401 e0001400 00c04000 d0000001 0c000380 00060403 24060000 00800e10 |