On Target RDRP_SARS2 0.118421055/CHEMBL4065616
For the given ligand C1, we have found in our database that, being scored 0.118421055, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| C1 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc3ccc2c(=O)c1ccccc1[oH+]c2c3O | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 00000000 42000c08 20000108 40018202 00001000 00820000 02000001 01000600 00040104 00980840 08000000 40008800 0000c002 20000000 01000001 2000a008 00000000 02100000 00082000 00020a00 00400000 08020300 00008000 06420014 00000000 e8000000 00400800 40200000 00000380 00020002 87020400 00000400 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |