On Target NS5B_HCV1B 0.21973094/CHEMBL3645180
For the given ligand C1, we have found in our database that, being scored 0.21973094, the most similar ligand is CHEMBL3645180. Check out the elaboration below.
| C1 (Given Ligand) | CHEMBL3645180 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc3ccc2c(=O)c1ccccc1[oH+]c2c3O | CCN(c1cc2nn(-c3ccc(Oc4ccccc4F)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 00000000 42000c08 20000108 40018202 00001000 00820000 02000001 01000600 00040104 00980840 08000000 40008800 0000c002 20000000 01000001 2000a008 00000000 02100000 00082000 00020a00 00400000 08020300 00008000 06420014 00000000 e8000000 00400800 40200000 00000380 00020002 87020400 00000400 | 00004006 00805e08 2018090a 43310e00 010c1000 00004052 02040000 02001408 00100900 000908c0 09312024 40118800 80008c23 01401201 810a0841 000e200c 04268800 02000004 08602008 00224201 c0500101 3c838e38 20800800 8360001c 02104080 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |