On Target PA_INFA 0.46153846/CHEMBL573638
For the given ligand C1, we have found in our database that, being scored 0.46153846, the most similar ligand is CHEMBL573638. Check out the elaboration below.
| C1 (Given Ligand) | CHEMBL573638 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc3ccc2c(=O)c1ccccc1[oH+]c2c3O | O=C(O)/C(O)=C/C(=O)c1ccc(Oc2ccccc2)cc1 |
|
|
|
|
|
|
| 00000000 42000c08 20000108 40018202 00001000 00820000 02000001 01000600 00040104 00980840 08000000 40008800 0000c002 20000000 01000001 2000a008 00000000 02100000 00082000 00020a00 00400000 08020300 00008000 06420014 00000000 e8000000 00400800 40200000 00000380 00020002 87020400 00000400 | 00000000 00000808 20000109 00010200 00001000 00800000 02040001 00000400 01000000 00980840 08000000 4000c000 80008002 00000000 01000001 00080008 00000400 02100000 00252010 00020800 00400000 18020a80 04008000 00400014 00001000 84004400 00520000 00200000 00004200 00020002 84000400 00000400 |