On Target ACE2_HUMAN 0.29655173/CHEMBL251804
For the given ligand C1, we have found in our database that, being scored 0.29655173, the most similar ligand is CHEMBL251804. Check out the elaboration below.
| C1 (Given Ligand) | CHEMBL251804 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc3ccc2c(=O)c1ccccc1[oH+]c2c3O | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccccc1Oc1ccccc1)C(=O)O |
|
|
|
|
|
|
| 00000000 42000c08 20000108 40018202 00001000 00820000 02000001 01000600 00040104 00980840 08000000 40008800 0000c002 20000000 01000001 2000a008 00000000 02100000 00082000 00020a00 00400000 08020300 00008000 06420014 00000000 e8000000 00400800 40200000 00000380 00020002 87020400 00000400 | 00010000 01005008 20100108 00118600 00001080 00000000 86000000 20000204 00000884 020a08c0 08300000 4001b0c0 06008002 00040000 81080001 00082008 90000000 02000000 00402008 00020201 00400100 18200e00 03000140 85500418 00000800 c0000000 00000000 10200040 04000300 00070003 20024400 03012600 |