On Target PLP_SARS 0.22274882/CHEMBL426898
For the given ligand Inophinone, we have found in our database that, being scored 0.22274882, the most similar ligand is CHEMBL426898. Check out the elaboration below.
| Inophinone (Given Ligand) | CHEMBL426898 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc4c1OC(C)(C)/C=C\c1c(O)c5c(=O)c3c2OC(C)(C)/C=C\c2c(O)cc3oc45 | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2o1 |
|
|
|
|
|
|
| 04000041 00200028 280a0308 04010202 00201201 80800120 c2000081 40000600 060c4004 40980840 48000020 40008000 46808422 00200088 01000003 10082008 00000420 02108040 1800001c 00820800 00040000 0a010008 0020d000 00580010 09201200 c0004401 00522099 4a900400 10416300 81a20802 04000000 00000410 | 04108002 00200808 60084109 00010200 00041200 04004004 80080000 41200200 02004100 20000840 00000124 4004a800 46808c0c 08010082 01030022 020c000c 00024000 02002000 00200008 00020000 40000000 08068b28 30800000 00c89204 28002c40 a0082380 04000214 08000000 00002281 01020000 c0005000 10020000 |