On Target PLP_SARS 0.25146198/CHEMBL222735
For the given ligand Pyranojacareubin, we have found in our database that, being scored 0.25146198, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| Pyranojacareubin (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| CC5(C)/C=C\c4c(cc3[oH+]c2c(O)c1OC(C)(C)/C=C\c1cc2c(=O)c3c4O)O5 | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 04000001 42000828 20000309 00218200 00201001 00020000 c2240080 01000600 04000004 00180840 48000000 40108a00 0680c002 00000000 01000003 2808a008 00000400 02008004 1000201c 00020a00 00440000 08020300 00008021 06420014 01001000 e8000000 00522808 40200400 00454380 80220102 87020400 00000410 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |