On Target PLP_SARS 0.22839506/CHEMBL222735
For the given ligand Phylattrin, we have found in our database that, being scored 0.22839506, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| Phylattrin (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| COc3cc2[oH+]c1c(O)cc(C/C=C(C)\C)c(OC)c1c(=O)c2c(C)c3C/C=C(C)/C | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 00000001 42000c08 20000109 00018202 00001001 00828000 42040401 01000600 80040004 00980a40 08000000 40008a00 0000c022 00200000 01000001 2808a008 00000000 02100004 00082000 00020a00 00400000 08020300 0000c028 06420014 00200000 e8000000 005a0800 40a00000 02000380 00020002 87020400 02000400 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |