On Target NA_A-H3N8 0.19313304/CHEMBL4292576
For the given ligand Inophinone, we have found in our database that, being scored 0.19313304, the most similar ligand is CHEMBL4292576. Check out the elaboration below.
| Inophinone (Given Ligand) | CHEMBL4292576 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc4c1OC(C)(C)/C=C\c1c(O)c5c(=O)c3c2OC(C)(C)/C=C\c2c(O)cc3oc45 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(OC)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 04000041 00200028 280a0308 04010202 00201201 80800120 c2000081 40000600 060c4004 40980840 48000020 40008000 46808422 00200088 01000003 10082008 00000420 02108040 1800001c 00820800 00040000 0a010008 0020d000 00580010 09201200 c0004401 00522099 4a900400 10416300 81a20802 04000000 00000410 | 00070040 09007008 20100108 84010700 00181080 00000800 020c0180 3a00140a 11000000 001108c8 40200000 41019001 0402881a 01882000 01001409 00081008 10a04000 02000060 60c12010 00020201 00000020 38048e80 13008080 02500018 10001401 c0001400 00e24000 90000001 0c000300 00060401 24060000 00800a10 |