On Target NA_A-H3N8 0.20873787/CHEMBL4282553
For the given ligand Phylattrin, we have found in our database that, being scored 0.20873787, the most similar ligand is CHEMBL4282553. Check out the elaboration below.
| Phylattrin (Given Ligand) | CHEMBL4282553 (Similar Ligand) |
|---|---|
| COc3cc2[oH+]c1c(O)cc(C/C=C(C)\C)c(OC)c1c(=O)c2c(C)c3C/C=C(C)/C | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(Oc3ccccc3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00000001 42000c08 20000109 00018202 00001001 00828000 42040401 01000600 80040004 00980a40 08000000 40008a00 0000c022 00200000 01000001 2808a008 00000000 02100004 00082000 00020a00 00400000 08020300 0000c028 06420014 00200000 e8000000 005a0800 40a00000 02000380 00020002 87020400 02000400 | 00070040 09007008 20100108 84010700 00181080 00000800 020c0180 3a00140a 11000000 001108c8 40200000 41019001 0402881a 01882000 01001409 00081008 10a04000 02000060 60c12010 00020201 00400020 38048e80 13008080 02500018 10001401 c0001400 00e24000 90200001 0c000300 00060401 24060400 00800a10 |