On Target NA_INFB 0.19323671/CHEMBL81286
For the given ligand Pyranojacareubin, we have found in our database that, being scored 0.19323671, the most similar ligand is CHEMBL81286. Check out the elaboration below.
| Pyranojacareubin (Given Ligand) | CHEMBL81286 (Similar Ligand) |
|---|---|
| CC5(C)/C=C\c4c(cc3[oH+]c2c(O)c1OC(C)(C)/C=C\c1cc2c(=O)c3c4O)O5 | CC[C@@H](CCc1ccccc1)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 04000001 42000828 20000309 00218200 00201001 00020000 c2240080 01000600 04000004 00180840 48000000 40108a00 0680c002 00000000 01000003 2808a008 00000400 02008004 1000201c 00020a00 00440000 08020300 00008021 06420014 01001000 e8000000 00522808 40200400 00454380 80220102 87020400 00000410 | 00070040 09007008 00100102 80010700 00180080 00000800 02080180 38000402 11000800 001808c8 48300000 41019001 0402801a 01a80000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000120 38040e80 13008040 02500018 10001400 80001400 00c04000 90000001 0c000202 00060403 04020000 00000610 |