On Target NA_INFB 0.18660288/CHEMBL113191
For the given ligand Soulattrin, we have found in our database that, being scored 0.18660288, the most similar ligand is CHEMBL113191. Check out the elaboration below.
| Soulattrin (Given Ligand) | CHEMBL113191 (Similar Ligand) |
|---|---|
| C=CC(C)(C)c3c(O)ccc4c(=O)c2c(O)c1/C=C\C(C)(C)Oc1c(O)c2[oH+]c34 | CC(=O)N[C@@H]1[C@@H](N)CC(C(=O)O)=C[C@H]1N(C)CCc1ccccc1 |
|
|
|
|
|
|
| 04000001 42000828 20000309 00218200 00201001 00820000 c2240081 01000600 04040004 00180a40 48040000 40108a00 0680c022 00000000 01000003 2808a008 00000400 02108004 1000201c 00020a00 00440000 08020300 00008021 06420014 01201000 e8000000 005a2808 40a00400 00454380 80220102 87020400 00000410 | 00030010 0900b400 00100100 04010600 00180000 00000000 00180180 3800040a 11000080 001809c8 08200000 41019000 0402811a 01812000 00000400 00080308 20004000 02000160 40412010 00000201 00000000 38240f90 01008001 83500018 00001000 88008c00 00484000 90000000 0c000000 00060413 04020000 02002600 |