On Target NS5B_HCV1B 0.17725752/CHEMBL3645188
For the given ligand Inophinone, we have found in our database that, being scored 0.17725752, the most similar ligand is CHEMBL3645188. Check out the elaboration below.
| Inophinone (Given Ligand) | CHEMBL3645188 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc4c1OC(C)(C)/C=C\c1c(O)c5c(=O)c3c2OC(C)(C)/C=C\c2c(O)cc3oc45 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3ccoc3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 04000041 00200028 280a0308 04010202 00201201 80800120 c2000081 40000600 060c4004 40980840 48000020 40008000 46808422 00200088 01000003 10082008 00000420 02108040 1800001c 00820800 00040000 0a010008 0020d000 00580010 09201200 c0004401 00522099 4a900400 10416300 81a20802 04000000 00000410 | 00004006 00a0de08 20180902 41310e00 210c0001 00004042 02050000 02201418 00124900 004909e0 0d312024 40118c00 c0008c33 01400201 c08a4440 200e200e 04268000 02030004 08600008 00225203 e0100101 1c8b8e3e 2080c800 9368001c 02104084 c0004048 00670090 8880108c 0c488104 0046005b e4048088 a81147e0 |