On Target NS5B_HCV1B 0.21176471/CHEMBL3645180
For the given ligand Pyranojacareubin, we have found in our database that, being scored 0.21176471, the most similar ligand is CHEMBL3645180. Check out the elaboration below.
| Pyranojacareubin (Given Ligand) | CHEMBL3645180 (Similar Ligand) |
|---|---|
| CC5(C)/C=C\c4c(cc3[oH+]c2c(O)c1OC(C)(C)/C=C\c1cc2c(=O)c3c4O)O5 | CCN(c1cc2nn(-c3ccc(Oc4ccccc4F)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 04000001 42000828 20000309 00218200 00201001 00020000 c2240080 01000600 04000004 00180840 48000000 40108a00 0680c002 00000000 01000003 2808a008 00000400 02008004 1000201c 00020a00 00440000 08020300 00008021 06420014 01001000 e8000000 00522808 40200400 00454380 80220102 87020400 00000410 | 00004006 00805e08 2018090a 43310e00 010c1000 00004052 02040000 02001408 00100900 000908c0 09312024 40118800 80008c23 01401201 810a0841 000e200c 04268800 02000004 08602008 00224201 c0500101 3c838e38 20800800 8360001c 02104080 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |