On Target RT_HIV1 0.21505377/CHEMBL3827839
For the given ligand Inophinone, we have found in our database that, being scored 0.21505377, the most similar ligand is CHEMBL3827839. Check out the elaboration below.
| Inophinone (Given Ligand) | CHEMBL3827839 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc4c1OC(C)(C)/C=C\c1c(O)c5c(=O)c3c2OC(C)(C)/C=C\c2c(O)cc3oc45 | C=C(C)[C@@H]1CC[C@]2(CNCCN(C)C)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 04000041 00200028 280a0308 04010202 00201201 80800120 c2000081 40000600 060c4004 40980840 48000020 40008000 46808422 00200088 01000003 10082008 00000420 02108040 1800001c 00820800 00040000 0a010008 0020d000 00580010 09201200 c0004401 00522099 4a900400 10416300 81a20802 04000000 00000410 | 00000000 01000800 00100302 44050600 00000000 00004000 80000080 20000402 00000900 001808c0 08300000 40018800 00028002 00202000 00000402 00080008 00000400 02000020 02012000 00000201 01000100 38020a30 00008021 02500014 01200000 80000000 00406000 d0000000 08400002 01060002 e4020000 00000600 |