On Target NS5B_HCV2A 0.1590909/CHEMBL4216436
For the given ligand Pyranojacareubin, we have found in our database that, being scored 0.1590909, the most similar ligand is CHEMBL4216436. Check out the elaboration below.
| Pyranojacareubin (Given Ligand) | CHEMBL4216436 (Similar Ligand) |
|---|---|
| CC5(C)/C=C\c4c(cc3[oH+]c2c(O)c1OC(C)(C)/C=C\c1cc2c(=O)c3c4O)O5 | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N2c2ccc([Si](C)(C)C)cc2)cc1)C(C)C |
|
|
|
|
|
|
| 04000001 42000828 20000309 00218200 00201001 00020000 c2240080 01000600 04000004 00180840 48000000 40108a00 0680c002 00000000 01000003 2808a008 00000400 02008004 1000201c 00020a00 00440000 08020300 00008021 06420014 01001000 e8000000 00522808 40200400 00454380 80220102 87020400 00000410 | 00014002 01003800 00500122 c4010600 20000000 0001a010 00000020 22001008 00980a20 00080ac0 08380004 4021f000 0e008812 0030a001 80020440 00120088 00062000 020c0000 08022010 08000201 40100100 38048e30 20052003 0250001a 00000000 e0000002 00000000 900000a0 08008382 00068003 a0044000 00006600 |