On Target PR_HIV1 0.14859438/CHEMBL494500
For the given ligand Inophinone, we have found in our database that, being scored 0.14859438, the most similar ligand is CHEMBL494500. Check out the elaboration below.
| Inophinone (Given Ligand) | CHEMBL494500 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc4c1OC(C)(C)/C=C\c1c(O)c5c(=O)c3c2OC(C)(C)/C=C\c2c(O)cc3oc45 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCCOCC2)cc1 |
|
|
|
|
|
|
| 04000041 00200028 280a0308 04010202 00201201 80800120 c2000081 40000600 060c4004 40980840 48000020 40008000 46808422 00200088 01000003 10082008 00000420 02108040 1800001c 00820800 00040000 0a010008 0020d000 00580010 09201200 c0004401 00522099 4a900400 10416300 81a20802 04000000 00000410 | 00000050 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000004 00540a00 014809e0 08342000 60018000 00008002 00a00101 81e80001 001a1008 10822000 02080000 11402800 01027603 80000120 18280c90 03100040 d9500058 02000400 8000100e 00800000 1020008c 04000600 2006001b 80000000 00012670 |