On Target PR_HIV1 0.19512194/CHEMBL492666
For the given ligand Phylattrin, we have found in our database that, being scored 0.19512194, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| Phylattrin (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| COc3cc2[oH+]c1c(O)cc(C/C=C(C)\C)c(OC)c1c(=O)c2c(C)c3C/C=C(C)/C | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00000001 42000c08 20000109 00018202 00001001 00828000 42040401 01000600 80040004 00980a40 08000000 40008a00 0000c022 00200000 01000001 2808a008 00000000 02100004 00082000 00020a00 00400000 08020300 0000c028 06420014 00200000 e8000000 005a0800 40a00000 02000380 00020002 87020400 02000400 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |