On Target PR_HIV1 0.20982143/CHEMBL510485
For the given ligand Inophinnin, we have found in our database that, being scored 0.20982143, the most similar ligand is CHEMBL510485. Check out the elaboration below.
| Inophinnin (Given Ligand) | CHEMBL510485 (Similar Ligand) |
|---|---|
| COc3c(C/C=C(C)\C)cc(O)c4[oH+]c2c1O[C@@H](C)C(C)(C)c1cc(O)c2c(=O)c34 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCCOCCOC2)cc1 |
|
|
|
|
|
|
| 04001001 42000c08 20000108 40218202 00001041 c2820000 42040001 01000640 00140904 00980a40 08100000 40008a40 0080c022 20000080 01044001 2a08a018 08000000 02108004 04082000 00020a01 00400100 08020300 01008020 06420014 00200000 e8000000 005a0800 40a00000 00000380 0002000a 87020400 02000440 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e80001 001a8008 10022000 02080000 01400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000000e 00800000 102000ec 04000600 20060013 80000000 00012670 |