On Target GP_EBOV 0.32467532/CHEMBL1655
For the given ligand Inophinnin, we have found in our database that, being scored 0.32467532, the most similar ligand is CHEMBL1655. Check out the elaboration below.
| Inophinnin (Given Ligand) | CHEMBL1655 (Similar Ligand) |
|---|---|
| COc3c(C/C=C(C)\C)cc(O)c4[oH+]c2c1O[C@@H](C)C(C)(C)c1cc(O)c2c(=O)c34 | CN(C)CCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1 |
|
|
|
|
|
|
| 04001001 42000c08 20000108 40218202 00001041 c2820000 42040001 01000640 00140904 00980a40 08100000 40008a40 0080c022 20000080 01044001 2a08a018 08000000 02108004 04082000 00020a01 00400100 08020300 01008020 06420014 00200000 e8000000 005a0800 40a00000 00000380 0002000a 87020400 02000440 | 04022000 00000008 20000308 00010602 00001080 00000000 82040080 01008400 00000800 00180840 08300500 40018000 00800002 00000000 01001003 00080008 00000400 02000000 00000000 00020001 00000100 18040100 12008081 00400010 01000000 a8000000 00522000 40000008 00400280 00060002 04000000 00820600 |