On Target DPM_HHV1K 0.15636364/CHEMBL479371
For the given ligand Pyranojacareubin, we have found in our database that, being scored 0.15636364, the most similar ligand is CHEMBL479371. Check out the elaboration below.
| Pyranojacareubin (Given Ligand) | CHEMBL479371 (Similar Ligand) |
|---|---|
| CC5(C)/C=C\c4c(cc3[oH+]c2c(O)c1OC(C)(C)/C=C\c1cc2c(=O)c3c4O)O5 | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccccn1 |
|
|
|
|
|
|
| 04000001 42000828 20000309 00218200 00201001 00020000 c2240080 01000600 04000004 00180840 48000000 40108a00 0680c002 00000000 01000003 2808a008 00000400 02008004 1000201c 00020a00 00440000 08020300 00008021 06420014 01001000 e8000000 00522808 40200400 00454380 80220102 87020400 00000410 | 1401818a 00a2d800 00184120 10014610 040416a3 80004000 00004400 42281200 020843e1 80080ad0 09208434 4081b802 c6009c6e 01600188 01020460 020c040c 1002e000 ca804004 02200080 08000200 c0000000 1a268f30 22a04002 a158001c 10843020 e0000002 0c940054 98040000 04402104 03860043 e0140000 a0020600 |