On Target PA_INFA 0.30379745/CHEMBL573638
For the given ligand Inophinone, we have found in our database that, being scored 0.30379745, the most similar ligand is CHEMBL573638. Check out the elaboration below.
| Inophinone (Given Ligand) | CHEMBL573638 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc4c1OC(C)(C)/C=C\c1c(O)c5c(=O)c3c2OC(C)(C)/C=C\c2c(O)cc3oc45 | O=C(O)/C(O)=C/C(=O)c1ccc(Oc2ccccc2)cc1 |
|
|
|
|
|
|
| 04000041 00200028 280a0308 04010202 00201201 80800120 c2000081 40000600 060c4004 40980840 48000020 40008000 46808422 00200088 01000003 10082008 00000420 02108040 1800001c 00820800 00040000 0a010008 0020d000 00580010 09201200 c0004401 00522099 4a900400 10416300 81a20802 04000000 00000410 | 00000000 00000808 20000109 00010200 00001000 00800000 02040001 00000400 01000000 00980840 08000000 4000c000 80008002 00000000 01000001 00080008 00000400 02100000 00252010 00020800 00400000 18020a80 04008000 00400014 00001000 84004400 00520000 00200000 00004200 00020002 84000400 00000400 |