On Target PA_INFA 0.3916084/CHEMBL573638
For the given ligand Soulattrin, we have found in our database that, being scored 0.3916084, the most similar ligand is CHEMBL573638. Check out the elaboration below.
| Soulattrin (Given Ligand) | CHEMBL573638 (Similar Ligand) |
|---|---|
| C=CC(C)(C)c3c(O)ccc4c(=O)c2c(O)c1/C=C\C(C)(C)Oc1c(O)c2[oH+]c34 | O=C(O)/C(O)=C/C(=O)c1ccc(Oc2ccccc2)cc1 |
|
|
|
|
|
|
| 04000001 42000828 20000309 00218200 00201001 00820000 c2240081 01000600 04040004 00180a40 48040000 40108a00 0680c022 00000000 01000003 2808a008 00000400 02108004 1000201c 00020a00 00440000 08020300 00008021 06420014 01201000 e8000000 005a2808 40a00400 00454380 80220102 87020400 00000410 | 00000000 00000808 20000109 00010200 00001000 00800000 02040001 00000400 01000000 00980840 08000000 4000c000 80008002 00000000 01000001 00080008 00000400 02100000 00252010 00020800 00400000 18020a80 04008000 00400014 00001000 84004400 00520000 00200000 00004200 00020002 84000400 00000400 |