On Target ACE2_HUMAN 0.25668448/CHEMBL251804
For the given ligand Soulattrin, we have found in our database that, being scored 0.25668448, the most similar ligand is CHEMBL251804. Check out the elaboration below.
| Soulattrin (Given Ligand) | CHEMBL251804 (Similar Ligand) |
|---|---|
| C=CC(C)(C)c3c(O)ccc4c(=O)c2c(O)c1/C=C\C(C)(C)Oc1c(O)c2[oH+]c34 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccccc1Oc1ccccc1)C(=O)O |
|
|
|
|
|
|
| 04000001 42000828 20000309 00218200 00201001 00820000 c2240081 01000600 04040004 00180a40 48040000 40108a00 0680c022 00000000 01000003 2808a008 00000400 02108004 1000201c 00020a00 00440000 08020300 00008021 06420014 01201000 e8000000 005a2808 40a00400 00454380 80220102 87020400 00000410 | 00010000 01005008 20100108 00118600 00001080 00000000 86000000 20000204 00000884 020a08c0 08300000 4001b0c0 06008002 00040000 81080001 00082008 90000000 02000000 00402008 00020201 00400100 18200e00 03000140 85500418 00000800 c0000000 00000000 10200040 04000300 00070003 20024400 03012600 |